About 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol
3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol (PubChem CID 26345552) has the molecular formula C22H20FNOS
and a molecular weight of 365.47 g/mol. Its IUPAC name is 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol.
Molecular Properties
| Compound Name | 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol |
| PubChem CID | 26345552 |
| Molecular Formula | C22H20FNOS |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol |
| SMILES | Oc1cccc(CN2CC[C@@H](c3cccc(F)c3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C22H20FNOS/c23-18-7-4-6-17(14-18)21-11-12-24(15-16-5-3-8-19(25)13-16)20-9-1-2-10-22(20)26-21/h1-10,13-14,21,25H,11-12,15H2/t21-/m0/s1 |
| InChIKey | BVLDFKQFBBMKKY-NRFANRHFSA-N |
| XLogP | 5.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol?
The IUPAC name of 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol (CID 26345552) is 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol.
What is the SMILES notation for 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol?
The canonical SMILES for 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol is Oc1cccc(CN2CC[C@@H](c3cccc(F)c3)Sc3ccccc32)c1.
What is the InChIKey of 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol?
The InChIKey is BVLDFKQFBBMKKY-NRFANRHFSA-N. The full InChI is InChI=1S/C22H20FNOS/c23-18-7-4-6-17(14-18)21-11-12-24(15-16-5-3-8-19(25)13-16)20-9-1-2-10-22(20)26-21/h1-10,13-14,21,25H,11-12,15H2/t21-/m0/s1.
What are the key properties of 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol?
3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol has a molecular weight of 365.47 g/mol, XLogP of 5.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S)-2-(3-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol is sourced from PubChem (CID 26345552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).