C24H24N4OS — CID 26350544
[5-methyl-4-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl]-spiro[indene-1,4'-piperidine]-1'-ylmethanone (PubChem CID 26350544) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is [5-methyl-4-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl]-spiro[indene-1,4'-piperidine]-1'-ylmethanone.
| Compound Name | [5-methyl-4-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl]-spiro[indene-1,4'-piperidine]-1'-ylmethanone |
|---|---|
| PubChem CID | 26350544 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [5-methyl-4-(prop-2-enylamino)thieno[2,3-d]pyrimidin-6-yl]-spiro[indene-1,4'-piperidine]-1'-ylmethanone |
| SMILES | C=CCNc1ncnc2sc(C(=O)N3CCC4(C=Cc5ccccc54)CC3)c(C)c12 |
| InChI | InChI=1S/C24H24N4OS/c1-3-12-25-21-19-16(2)20(30-22(19)27-15-26-21)23(29)28-13-10-24(11-14-28)9-8-17-6-4-5-7-18(17)24/h3-9,15H,1,10-14H2,2H3,(H,25,26,27) |
| InChIKey | AZYSBRJURBOLQC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|