C24H27FN6O2 — CID 26351275
(2S,4R)-N-[2-(4-fluorophenyl)ethyl]-1-[(2-prop-2-enoxyphenyl)methyl]-4-(tetrazol-1-yl)pyrrolidine-2-carboxamide (PubChem CID 26351275) has the molecular formula C24H27FN6O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is (2S,4R)-N-[2-(4-fluorophenyl)ethyl]-1-[(2-prop-2-enoxyphenyl)methyl]-4-(tetrazol-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[2-(4-fluorophenyl)ethyl]-1-[(2-prop-2-enoxyphenyl)methyl]-4-(tetrazol-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 26351275 |
| Molecular Formula | C24H27FN6O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (2S,4R)-N-[2-(4-fluorophenyl)ethyl]-1-[(2-prop-2-enoxyphenyl)methyl]-4-(tetrazol-1-yl)pyrrolidine-2-carboxamide |
| SMILES | C=CCOc1ccccc1CN1C[C@H](n2cnnn2)C[C@H]1C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN6O2/c1-2-13-33-23-6-4-3-5-19(23)15-30-16-21(31-17-27-28-29-31)14-22(30)24(32)26-12-11-18-7-9-20(25)10-8-18/h2-10,17,21-22H,1,11-16H2,(H,26,32)/t21-,22+/m1/s1 |
| InChIKey | AQIYOWNYUQBDSJ-YADHBBJMSA-N |
| XLogP | 2.55 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|