C25H31NO3 — CID 26352511
N-[[4-(cyclobutylmethoxy)phenyl]methyl]-N-cyclopropyl-3-(2-methoxyphenyl)propanamide (PubChem CID 26352511) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[[4-(cyclobutylmethoxy)phenyl]methyl]-N-cyclopropyl-3-(2-methoxyphenyl)propanamide.
| Compound Name | N-[[4-(cyclobutylmethoxy)phenyl]methyl]-N-cyclopropyl-3-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 26352511 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[[4-(cyclobutylmethoxy)phenyl]methyl]-N-cyclopropyl-3-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1CCC(=O)N(Cc1ccc(OCC2CCC2)cc1)C1CC1 |
| InChI | InChI=1S/C25H31NO3/c1-28-24-8-3-2-7-21(24)11-16-25(27)26(22-12-13-22)17-19-9-14-23(15-10-19)29-18-20-5-4-6-20/h2-3,7-10,14-15,20,22H,4-6,11-13,16-18H2,1H3 |
| InChIKey | ZCYWTQFKFZTOIU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |