C15H22N4O — CID 26357627
2-(cyclohexen-1-yl)-1-(3-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)ethanone (PubChem CID 26357627) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-(3-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-(3-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)ethanone |
|---|---|
| PubChem CID | 26357627 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-(3-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)ethanone |
| SMILES | Cc1nnc2n1CCN(C(=O)CC1=CCCCC1)CC2 |
| InChI | InChI=1S/C15H22N4O/c1-12-16-17-14-7-8-18(9-10-19(12)14)15(20)11-13-5-3-2-4-6-13/h5H,2-4,6-11H2,1H3 |
| InChIKey | COGFMLRPYUSVOU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|