C22H14F3N3OS3 — CID 26357884
4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 26357884) has the molecular formula C22H14F3N3OS3 and a molecular weight of 489.57 g/mol. Its IUPAC name is 4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 26357884 |
| Molecular Formula | C22H14F3N3OS3 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(-n2nc(SCc3ccccc3)sc2=S)cc1 |
| InChI | InChI=1S/C22H14F3N3OS3/c23-16-10-11-17(19(25)18(16)24)26-20(29)14-6-8-15(9-7-14)28-22(30)32-21(27-28)31-12-13-4-2-1-3-5-13/h1-11H,12H2,(H,26,29) |
| InChIKey | XARWFMRWUMUDTR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|