C23H26N3O2S+ — CID 2635803
N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)-2-(3-ethylphenoxy)acetamide (PubChem CID 2635803) has the molecular formula C23H26N3O2S+ and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)-2-(3-ethylphenoxy)acetamide.
| Compound Name | N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)-2-(3-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 2635803 |
| Molecular Formula | C23H26N3O2S+ |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-(5-benzyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)-2-(3-ethylphenoxy)acetamide |
| SMILES | CCc1cccc(OCC(=O)Nc2nc3c(s2)C[NH+](Cc2ccccc2)CC3)c1 |
| InChI | InChI=1S/C23H25N3O2S/c1-2-17-9-6-10-19(13-17)28-16-22(27)25-23-24-20-11-12-26(15-21(20)29-23)14-18-7-4-3-5-8-18/h3-10,13H,2,11-12,14-16H2,1H3,(H,24,25,27)/p+1 |
| InChIKey | PYNUAVOTZQRTGN-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |