C18H20N2O3S2 — CID 2635846
N-[2-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclobutanecarboxamide (PubChem CID 2635846) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 2635846 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[2-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]cyclobutanecarboxamide |
| SMILES | CSc1ccc(/C=C2/SC(=O)N(CCNC(=O)C3CCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-24-14-7-5-12(6-8-14)11-15-17(22)20(18(23)25-15)10-9-19-16(21)13-3-2-4-13/h5-8,11,13H,2-4,9-10H2,1H3,(H,19,21)/b15-11+ |
| InChIKey | DEFYQAMMLYFZHC-RVDMUPIBSA-N |
| XLogP | 3.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|