C24H24N2OS — CID 26358983
(1S)-N-[[2-(4-methoxyphenyl)-7-methylquinolin-3-yl]methyl]-1-thiophen-2-ylethanamine (PubChem CID 26358983) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is (1S)-N-[[2-(4-methoxyphenyl)-7-methylquinolin-3-yl]methyl]-1-thiophen-2-ylethanamine.
| Compound Name | (1S)-N-[[2-(4-methoxyphenyl)-7-methylquinolin-3-yl]methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 26358983 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (1S)-N-[[2-(4-methoxyphenyl)-7-methylquinolin-3-yl]methyl]-1-thiophen-2-ylethanamine |
| SMILES | COc1ccc(-c2nc3cc(C)ccc3cc2CN[C@@H](C)c2cccs2)cc1 |
| InChI | InChI=1S/C24H24N2OS/c1-16-6-7-19-14-20(15-25-17(2)23-5-4-12-28-23)24(26-22(19)13-16)18-8-10-21(27-3)11-9-18/h4-14,17,25H,15H2,1-3H3/t17-/m0/s1 |
| InChIKey | GHCYTFLLXIMCEV-KRWDZBQOSA-N |
| XLogP | 6.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |