C20H28N4OS — CID 26359352
4-[2-(cyclohexen-1-yl)ethylamino]-N,5-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 26359352) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-[2-(cyclohexen-1-yl)ethylamino]-N,5-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N,5-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 26359352 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[2-(cyclohexen-1-yl)ethylamino]-N,5-dimethyl-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C(C)C)sc2ncnc(NCCC3=CCCCC3)c12 |
| InChI | InChI=1S/C20H28N4OS/c1-13(2)24(4)20(25)17-14(3)16-18(22-12-23-19(16)26-17)21-11-10-15-8-6-5-7-9-15/h8,12-13H,5-7,9-11H2,1-4H3,(H,21,22,23) |
| InChIKey | WKKSESHQFIAIFF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|