About 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione
4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 2635970) has the molecular formula C21H21N7S2
and a molecular weight of 435.58 g/mol. Its IUPAC name is 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
Molecular Properties
| Compound Name | 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| PubChem CID | 2635970 |
| Molecular Formula | C21H21N7S2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCN(c3ncccn3)CC2)nc(-c2cccs2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N7S2/c29-21-27(16-25-11-13-26(14-12-25)20-22-9-5-10-23-20)24-19(18-8-4-15-30-18)28(21)17-6-2-1-3-7-17/h1-10,15H,11-14,16H2 |
| InChIKey | BTAKZDCCLYEMAU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione?
The IUPAC name of 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (CID 2635970) is 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
What is the SMILES notation for 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione?
The canonical SMILES for 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione is S=c1n(CN2CCN(c3ncccn3)CC2)nc(-c2cccs2)n1-c1ccccc1.
What is the InChIKey of 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione?
The InChIKey is BTAKZDCCLYEMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7S2/c29-21-27(16-25-11-13-26(14-12-25)20-22-9-5-10-23-20)24-19(18-8-4-15-30-18)28(21)17-6-2-1-3-7-17/h1-10,15H,11-14,16H2.
What are the key properties of 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione?
4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione has a molecular weight of 435.58 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione is sourced from PubChem (CID 2635970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).