C20H21N5OS — CID 2636283
2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 2636283) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 2636283 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Cn1c(SCC(=O)N[C@@H]2CCCc3ccccc32)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H21N5OS/c1-25-19(15-9-11-21-12-10-15)23-24-20(25)27-13-18(26)22-17-8-4-6-14-5-2-3-7-16(14)17/h2-3,5,7,9-12,17H,4,6,8,13H2,1H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | PDLBHLKOAWOYBO-QGZVFWFLSA-N |
| XLogP | 3.16 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |