C17H16BrNO3 — CID 26364650
(E)-3-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 26364650) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26364650 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C17H16BrNO3/c1-21-15-9-8-14(11-16(15)22-2)19-17(20)10-5-12-3-6-13(18)7-4-12/h3-11H,1-2H3,(H,19,20)/b10-5+ |
| InChIKey | LERMCKNZCWIMSB-BJMVGYQFSA-N |
| XLogP | 4.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|