C30H27N3O2S — CID 26366093
(5Z)-3-(2,4-dimethylphenyl)-2-(2,4-dimethylphenyl)imino-5-(2-oxo-1-prop-2-enylindol-3-ylidene)-1,3-thiazolidin-4-one (PubChem CID 26366093) has the molecular formula C30H27N3O2S and a molecular weight of 493.63 g/mol. Its IUPAC name is (5Z)-3-(2,4-dimethylphenyl)-2-(2,4-dimethylphenyl)imino-5-(2-oxo-1-prop-2-enylindol-3-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2,4-dimethylphenyl)-2-(2,4-dimethylphenyl)imino-5-(2-oxo-1-prop-2-enylindol-3-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 26366093 |
| Molecular Formula | C30H27N3O2S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (5Z)-3-(2,4-dimethylphenyl)-2-(2,4-dimethylphenyl)imino-5-(2-oxo-1-prop-2-enylindol-3-ylidene)-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2\S/C(=N\c3ccc(C)cc3C)N(c3ccc(C)cc3C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C30H27N3O2S/c1-6-15-32-25-10-8-7-9-22(25)26(28(32)34)27-29(35)33(24-14-12-19(3)17-21(24)5)30(36-27)31-23-13-11-18(2)16-20(23)4/h6-14,16-17H,1,15H2,2-5H3/b27-26-,31-30- |
| InChIKey | VDKGKRHQKHYXFE-GUIRJEEQSA-N |
| XLogP | 6.63 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|