C22H23BrN4O3S — CID 26366262
(6R)-10-bromo-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 26366262) has the molecular formula C22H23BrN4O3S and a molecular weight of 503.42 g/mol. Its IUPAC name is (6R)-10-bromo-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-10-bromo-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 26366262 |
| Molecular Formula | C22H23BrN4O3S |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | (6R)-10-bromo-3-butylsulfanyl-6-(2,4-dimethoxyphenyl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCSc1nnc2c(n1)O[C@H](c1ccc(OC)cc1OC)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C22H23BrN4O3S/c1-4-5-10-31-22-25-21-19(26-27-22)16-11-13(23)6-9-17(16)24-20(30-21)15-8-7-14(28-2)12-18(15)29-3/h6-9,11-12,20,24H,4-5,10H2,1-3H3/t20-/m1/s1 |
| InChIKey | JKUQBDLURWRBRM-HXUWFJFHSA-N |
| XLogP | 5.71 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|