C23H17N5O5S — CID 26366690
1-[(6S)-3-methylsulfanyl-6-[5-(4-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 26366690) has the molecular formula C23H17N5O5S and a molecular weight of 475.49 g/mol. Its IUPAC name is 1-[(6S)-3-methylsulfanyl-6-[5-(4-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6S)-3-methylsulfanyl-6-[5-(4-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 26366690 |
| Molecular Formula | C23H17N5O5S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-[(6S)-3-methylsulfanyl-6-[5-(4-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CSc1nnc2c(n1)O[C@@H](c1ccc(-c3ccc([N+](=O)[O-])cc3)o1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H17N5O5S/c1-13(29)27-17-6-4-3-5-16(17)20-21(24-23(34-2)26-25-20)33-22(27)19-12-11-18(32-19)14-7-9-15(10-8-14)28(30)31/h3-12,22H,1-2H3/t22-/m0/s1 |
| InChIKey | MQPNOPZVOCSNRD-QFIPXVFZSA-N |
| XLogP | 4.87 |
| TPSA | 124.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|