C20H21NO4 — CID 26367250
4-[(4aS,5R,10bS)-9-methoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzoic acid (PubChem CID 26367250) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 4-[(4aS,5R,10bS)-9-methoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzoic acid.
| Compound Name | 4-[(4aS,5R,10bS)-9-methoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 26367250 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[(4aS,5R,10bS)-9-methoxy-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzoic acid |
| SMILES | COc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](c1ccc(C(=O)O)cc1)N2 |
| InChI | InChI=1S/C20H21NO4/c1-24-14-8-9-17-16(11-14)19-15(3-2-10-25-19)18(21-17)12-4-6-13(7-5-12)20(22)23/h4-9,11,15,18-19,21H,2-3,10H2,1H3,(H,22,23)/t15-,18-,19-/m0/s1 |
| InChIKey | OCCRAOGGTJCSKO-SNRMKQJTSA-N |
| XLogP | 4.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|