C22H26BrNO3 — CID 26367303
(4aS,5R,10bS)-5-(3-bromo-4-ethoxy-5-methoxyphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 26367303) has the molecular formula C22H26BrNO3 and a molecular weight of 432.36 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-(3-bromo-4-ethoxy-5-methoxyphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-(3-bromo-4-ethoxy-5-methoxyphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 26367303 |
| Molecular Formula | C22H26BrNO3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (4aS,5R,10bS)-5-(3-bromo-4-ethoxy-5-methoxyphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCOc1c(Br)cc([C@@H]2Nc3ccc(C)cc3[C@H]3OCCC[C@H]32)cc1OC |
| InChI | InChI=1S/C22H26BrNO3/c1-4-26-22-17(23)11-14(12-19(22)25-3)20-15-6-5-9-27-21(15)16-10-13(2)7-8-18(16)24-20/h7-8,10-12,15,20-21,24H,4-6,9H2,1-3H3/t15-,20-,21-/m0/s1 |
| InChIKey | FXGRUGYLXNKCAH-JHVJFLLYSA-N |
| XLogP | 5.80 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |