C20H23NO — CID 26367815
(4aS,5R,10bS)-7,9-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 26367815) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (4aS,5R,10bS)-7,9-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-7,9-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 26367815 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (4aS,5R,10bS)-7,9-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Cc1cc(C)c2c(c1)[C@H]1OCCC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H23NO/c1-13-11-14(2)18-17(12-13)20-16(9-6-10-22-20)19(21-18)15-7-4-3-5-8-15/h3-5,7-8,11-12,16,19-21H,6,9-10H2,1-2H3/t16-,19-,20-/m0/s1 |
| InChIKey | WCCHGUMZPFCXTI-VDGAXYAQSA-N |
| XLogP | 4.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |