About 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde
2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde (PubChem CID 26368558) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde |
| PubChem CID | 26368558 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde |
| SMILES | CCN(CC)c1nc2c(C)ccc(C)c2cc1C=O |
| InChI | InChI=1S/C16H20N2O/c1-5-18(6-2)16-13(10-19)9-14-11(3)7-8-12(4)15(14)17-16/h7-10H,5-6H2,1-4H3 |
| InChIKey | AAWRBDXMXQKLPX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde?
The IUPAC name of 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde (CID 26368558) is 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde.
What is the SMILES notation for 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde?
The canonical SMILES for 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde is CCN(CC)c1nc2c(C)ccc(C)c2cc1C=O.
What is the InChIKey of 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde?
The InChIKey is AAWRBDXMXQKLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O/c1-5-18(6-2)16-13(10-19)9-14-11(3)7-8-12(4)15(14)17-16/h7-10H,5-6H2,1-4H3.
What are the key properties of 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde?
2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde has a molecular weight of 256.35 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-5,8-dimethylquinoline-3-carbaldehyde is sourced from PubChem (CID 26368558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).