C26H32N6O2S2 — CID 26370627
(1S,5S)-2,6-bis(morpholin-4-ylmethyl)-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 26370627) has the molecular formula C26H32N6O2S2 and a molecular weight of 524.72 g/mol. Its IUPAC name is (1S,5S)-2,6-bis(morpholin-4-ylmethyl)-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | (1S,5S)-2,6-bis(morpholin-4-ylmethyl)-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 26370627 |
| Molecular Formula | C26H32N6O2S2 |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (1S,5S)-2,6-bis(morpholin-4-ylmethyl)-1,5-diphenyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | S=C1N(CN2CCOCC2)[C@H](c2ccccc2)N2C(=S)N(CN3CCOCC3)[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C26H32N6O2S2/c35-25-29(19-27-11-15-33-16-12-27)23(21-7-3-1-4-8-21)31-26(36)30(20-28-13-17-34-18-14-28)24(32(25)31)22-9-5-2-6-10-22/h1-10,23-24H,11-20H2/t23-,24-/m0/s1 |
| InChIKey | MOOFEOPIZZORPP-ZEQRLZLVSA-N |
| XLogP | 2.68 |
| TPSA | 37.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|