About 2,3-dimethylheptane
2,3-dimethylheptane (PubChem CID 26375) has the molecular formula C9H20
and a molecular weight of 128.26 g/mol. Its IUPAC name is 2,3-dimethylheptane.
Molecular Properties
| Compound Name | 2,3-dimethylheptane |
| PubChem CID | 26375 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | 2,3-dimethylheptane |
| SMILES | CCCCC(C)C(C)C |
| InChI | InChI=1S/C9H20/c1-5-6-7-9(4)8(2)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | WBRFDUJXCLCKPX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylheptane?
The IUPAC name of 2,3-dimethylheptane (CID 26375) is 2,3-dimethylheptane.
What is the SMILES notation for 2,3-dimethylheptane?
The canonical SMILES for 2,3-dimethylheptane is CCCCC(C)C(C)C.
What is the InChIKey of 2,3-dimethylheptane?
The InChIKey is WBRFDUJXCLCKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20/c1-5-6-7-9(4)8(2)3/h8-9H,5-7H2,1-4H3.
What are the key properties of 2,3-dimethylheptane?
2,3-dimethylheptane has a molecular weight of 128.26 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylheptane is sourced from PubChem (CID 26375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).