C11H12ClN3O6S — CID 2638592
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 2638592) has the molecular formula C11H12ClN3O6S and a molecular weight of 349.75 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2638592 |
| Molecular Formula | C11H12ClN3O6S |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H12ClN3O6S/c1-5(9(16)15-11(13)18)21-10(17)6-2-3-7(12)8(4-6)22(14,19)20/h2-5H,1H3,(H2,14,19,20)(H3,13,15,16,18)/t5-/m1/s1 |
| InChIKey | UJNROGVKECHJTE-RXMQYKEDSA-N |
| XLogP | -0.27 |
| TPSA | 158.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |