C13H20N6O3S — CID 26388979
ethyl 4-[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]piperazine-1-carboxylate (PubChem CID 26388979) has the molecular formula C13H20N6O3S and a molecular weight of 340.41 g/mol. Its IUPAC name is ethyl 4-[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 26388979 |
| Molecular Formula | C13H20N6O3S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | ethyl 4-[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CSc2nnnn2C2CC2)CC1 |
| InChI | InChI=1S/C13H20N6O3S/c1-2-22-13(21)18-7-5-17(6-8-18)11(20)9-23-12-14-15-16-19(12)10-3-4-10/h10H,2-9H2,1H3 |
| InChIKey | FHUIHOCOXIYYAK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |