C25H28N4O — CID 26390529
(1R)-1-(4-ethoxyphenyl)-2-[(1-ethylimidazol-2-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 26390529) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (1R)-1-(4-ethoxyphenyl)-2-[(1-ethylimidazol-2-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-1-(4-ethoxyphenyl)-2-[(1-ethylimidazol-2-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 26390529 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (1R)-1-(4-ethoxyphenyl)-2-[(1-ethylimidazol-2-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCOc1ccc([C@@H]2c3[nH]c4ccccc4c3CCN2Cc2nccn2CC)cc1 |
| InChI | InChI=1S/C25H28N4O/c1-3-28-16-14-26-23(28)17-29-15-13-21-20-7-5-6-8-22(20)27-24(21)25(29)18-9-11-19(12-10-18)30-4-2/h5-12,14,16,25,27H,3-4,13,15,17H2,1-2H3/t25-/m1/s1 |
| InChIKey | WSDPWQMBVRITME-RUZDIDTESA-N |
| XLogP | 4.93 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|