C17H30N2O4 — CID 26392962
ethyl 3-[[(2R)-2-(cyclohexylmethyl)morpholine-4-carbonyl]amino]propanoate (PubChem CID 26392962) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is ethyl 3-[[(2R)-2-(cyclohexylmethyl)morpholine-4-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(2R)-2-(cyclohexylmethyl)morpholine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 26392962 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | ethyl 3-[[(2R)-2-(cyclohexylmethyl)morpholine-4-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)N1CCO[C@H](CC2CCCCC2)C1 |
| InChI | InChI=1S/C17H30N2O4/c1-2-22-16(20)8-9-18-17(21)19-10-11-23-15(13-19)12-14-6-4-3-5-7-14/h14-15H,2-13H2,1H3,(H,18,21)/t15-/m1/s1 |
| InChIKey | OVYHOMXSMRMAOD-OAHLLOKOSA-N |
| XLogP | 2.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |