C24H24N4OS — CID 26393068
(1S,5S,7S)-7-(2,1,3-benzothiadiazol-5-yl)-3-(2,3-dihydro-1H-inden-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 26393068) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is (1S,5S,7S)-7-(2,1,3-benzothiadiazol-5-yl)-3-(2,3-dihydro-1H-inden-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-7-(2,1,3-benzothiadiazol-5-yl)-3-(2,3-dihydro-1H-inden-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 26393068 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (1S,5S,7S)-7-(2,1,3-benzothiadiazol-5-yl)-3-(2,3-dihydro-1H-inden-2-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | O=C1N(C2Cc3ccccc3C2)C[C@@H]2C[C@@H](c3ccc4nsnc4c3)N3CCC[C@@]123 |
| InChI | InChI=1S/C24H24N4OS/c29-23-24-8-3-9-28(24)22(17-6-7-20-21(12-17)26-30-25-20)13-18(24)14-27(23)19-10-15-4-1-2-5-16(15)11-19/h1-2,4-7,12,18-19,22H,3,8-11,13-14H2/t18-,22-,24-/m0/s1 |
| InChIKey | LDYIDKUIXASZQL-OEOAZWSVSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |