C29H34N2O4 — CID 26398787
[5-[4-hydroxy-1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1-benzofuran-2-yl]-piperidin-1-ylmethanone (PubChem CID 26398787) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is [5-[4-hydroxy-1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1-benzofuran-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-[4-hydroxy-1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1-benzofuran-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 26398787 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | [5-[4-hydroxy-1-[(2-prop-2-enoxyphenyl)methyl]piperidin-4-yl]-1-benzofuran-2-yl]-piperidin-1-ylmethanone |
| SMILES | C=CCOc1ccccc1CN1CCC(O)(c2ccc3oc(C(=O)N4CCCCC4)cc3c2)CC1 |
| InChI | InChI=1S/C29H34N2O4/c1-2-18-34-25-9-5-4-8-22(25)21-30-16-12-29(33,13-17-30)24-10-11-26-23(19-24)20-27(35-26)28(32)31-14-6-3-7-15-31/h2,4-5,8-11,19-20,33H,1,3,6-7,12-18,21H2 |
| InChIKey | DRKCWYBJHBYZQS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|