C22H26N2O — CID 26399021
(5R)-5-[2-(benzylamino)ethyl]-1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-one (PubChem CID 26399021) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (5R)-5-[2-(benzylamino)ethyl]-1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-(benzylamino)ethyl]-1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 26399021 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (5R)-5-[2-(benzylamino)ethyl]-1-(2,3-dihydro-1H-inden-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CCNCc2ccccc2)N1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H26N2O/c25-22-11-10-20(12-13-23-16-17-6-2-1-3-7-17)24(22)21-14-18-8-4-5-9-19(18)15-21/h1-9,20-21,23H,10-16H2/t20-/m1/s1 |
| InChIKey | OBDDFGNLAHNGCE-HXUWFJFHSA-N |
| XLogP | 3.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|