C24H31N3O6S — CID 26401059
methyl 3-[(5-acetamidothiophen-2-yl)methyl]-9-[[(2S)-oxan-2-yl]methoxy]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate (PubChem CID 26401059) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is methyl 3-[(5-acetamidothiophen-2-yl)methyl]-9-[[(2S)-oxan-2-yl]methoxy]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate.
| Compound Name | methyl 3-[(5-acetamidothiophen-2-yl)methyl]-9-[[(2S)-oxan-2-yl]methoxy]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
|---|---|
| PubChem CID | 26401059 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | methyl 3-[(5-acetamidothiophen-2-yl)methyl]-9-[[(2S)-oxan-2-yl]methoxy]-7-oxo-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepine-10-carboxylate |
| SMILES | COC(=O)c1c(OC[C@@H]2CCCCO2)cc(=O)n2c1CCN(Cc1ccc(NC(C)=O)s1)CC2 |
| InChI | InChI=1S/C24H31N3O6S/c1-16(28)25-21-7-6-18(34-21)14-26-9-8-19-23(24(30)31-2)20(13-22(29)27(19)11-10-26)33-15-17-5-3-4-12-32-17/h6-7,13,17H,3-5,8-12,14-15H2,1-2H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | QLXRAPXRZJHRMK-KRWDZBQOSA-N |
| XLogP | 2.66 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |