2-cyano-2-phenylacetic acid

C9H7NO2 — CID 26403

IUPAC2-cyano-2-phenylacetic acid
SMILESN#CC(C(=O)O)c1ccccc1
InChIInChI=1S/C9H7NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8H,(H,11,12)
InChIKeyDKFPBXQCCCIWLC-UHFFFAOYSA-N
MW161.16 g/mol
LogP1.38
Rot. Bonds2

About 2-cyano-2-phenylacetic acid

2-cyano-2-phenylacetic acid (PubChem CID 26403) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-cyano-2-phenylacetic acid.

Molecular Properties

Compound Name2-cyano-2-phenylacetic acid
PubChem CID26403
Molecular FormulaC9H7NO2
Molecular Weight161.16 g/mol
Exact Mass161.05
IUPAC Name2-cyano-2-phenylacetic acid
SMILESN#CC(C(=O)O)c1ccccc1
InChIInChI=1S/C9H7NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8H,(H,11,12)
InChIKeyDKFPBXQCCCIWLC-UHFFFAOYSA-N
XLogP1.38
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-cyano-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyano-2-phenylacetic acid?
The IUPAC name of 2-cyano-2-phenylacetic acid (CID 26403) is 2-cyano-2-phenylacetic acid.
What is the SMILES notation for 2-cyano-2-phenylacetic acid?
The canonical SMILES for 2-cyano-2-phenylacetic acid is N#CC(C(=O)O)c1ccccc1.
What is the InChIKey of 2-cyano-2-phenylacetic acid?
The InChIKey is DKFPBXQCCCIWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8H,(H,11,12).
What are the key properties of 2-cyano-2-phenylacetic acid?
2-cyano-2-phenylacetic acid has a molecular weight of 161.16 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2-phenylacetic acid is sourced from PubChem (CID 26403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).