About 2-cyano-2-phenylacetic acid
2-cyano-2-phenylacetic acid (PubChem CID 26403) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-cyano-2-phenylacetic acid.
Molecular Properties
| Compound Name | 2-cyano-2-phenylacetic acid |
| PubChem CID | 26403 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2-cyano-2-phenylacetic acid |
| SMILES | N#CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H7NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8H,(H,11,12) |
| InChIKey | DKFPBXQCCCIWLC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-2-phenylacetic acid?
The IUPAC name of 2-cyano-2-phenylacetic acid (CID 26403) is 2-cyano-2-phenylacetic acid.
What is the SMILES notation for 2-cyano-2-phenylacetic acid?
The canonical SMILES for 2-cyano-2-phenylacetic acid is N#CC(C(=O)O)c1ccccc1.
What is the InChIKey of 2-cyano-2-phenylacetic acid?
The InChIKey is DKFPBXQCCCIWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8H,(H,11,12).
What are the key properties of 2-cyano-2-phenylacetic acid?
2-cyano-2-phenylacetic acid has a molecular weight of 161.16 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2-phenylacetic acid is sourced from PubChem (CID 26403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).