C21H26ClN3O2 — CID 26403321
3-[(3S)-1-(3-chloro-2-pyridinyl)piperidin-3-yl]-N-(4-methoxy-2-methylphenyl)propanamide (PubChem CID 26403321) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 3-[(3S)-1-(3-chloro-2-pyridinyl)piperidin-3-yl]-N-(4-methoxy-2-methylphenyl)propanamide.
| Compound Name | 3-[(3S)-1-(3-chloro-2-pyridinyl)piperidin-3-yl]-N-(4-methoxy-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 26403321 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[(3S)-1-(3-chloro-2-pyridinyl)piperidin-3-yl]-N-(4-methoxy-2-methylphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CC[C@@H]2CCCN(c3ncccc3Cl)C2)c(C)c1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-15-13-17(27-2)8-9-19(15)24-20(26)10-7-16-5-4-12-25(14-16)21-18(22)6-3-11-23-21/h3,6,8-9,11,13,16H,4-5,7,10,12,14H2,1-2H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | HYDZYMGHCXIWPK-INIZCTEOSA-N |
| XLogP | 4.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |