C21H34N2O2 — CID 26403532
(5R)-7-(2-cyclohexylethyl)-2-pent-4-enoyl-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 26403532) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (5R)-7-(2-cyclohexylethyl)-2-pent-4-enoyl-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-7-(2-cyclohexylethyl)-2-pent-4-enoyl-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 26403532 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | (5R)-7-(2-cyclohexylethyl)-2-pent-4-enoyl-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | C=CCCC(=O)N1CC[C@]2(CCCN(CCC3CCCCC3)C2=O)C1 |
| InChI | InChI=1S/C21H34N2O2/c1-2-3-10-19(24)23-16-13-21(17-23)12-7-14-22(20(21)25)15-11-18-8-5-4-6-9-18/h2,18H,1,3-17H2/t21-/m1/s1 |
| InChIKey | FJSRDXPHUYBHCK-OAQYLSRUSA-N |
| XLogP | 3.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|