C20H25N3OS — CID 26403604
N-[(3R)-1-(2-phenylethyl)piperidin-3-yl]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 26403604) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is N-[(3R)-1-(2-phenylethyl)piperidin-3-yl]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[(3R)-1-(2-phenylethyl)piperidin-3-yl]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 26403604 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[(3R)-1-(2-phenylethyl)piperidin-3-yl]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccccn1)N[C@@H]1CCCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3OS/c24-19(16-25-20-10-4-5-12-21-20)22-18-9-6-13-23(15-18)14-11-17-7-2-1-3-8-17/h1-5,7-8,10,12,18H,6,9,11,13-16H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | NWFIZSIOYOWZEF-GOSISDBHSA-N |
| XLogP | 3.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |