C21H23ClN2O2 — CID 26405826
N-[4-[[(3S)-3-(3-chlorobenzoyl)piperidin-1-yl]methyl]phenyl]acetamide (PubChem CID 26405826) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[4-[[(3S)-3-(3-chlorobenzoyl)piperidin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3S)-3-(3-chlorobenzoyl)piperidin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 26405826 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[4-[[(3S)-3-(3-chlorobenzoyl)piperidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCC[C@H](C(=O)c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C21H23ClN2O2/c1-15(25)23-20-9-7-16(8-10-20)13-24-11-3-5-18(14-24)21(26)17-4-2-6-19(22)12-17/h2,4,6-10,12,18H,3,5,11,13-14H2,1H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | PQEGTXWKESAGRY-SFHVURJKSA-N |
| XLogP | 4.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |