About N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine
N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine (PubChem CID 26406980) has the molecular formula C19H29N3O3S
and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine |
| PubChem CID | 26406980 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine |
| SMILES | COCCS(=O)(=O)c1ncc(CN(C)CC(C)C)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-16(2)13-21(3)15-18-12-20-19(26(23,24)11-10-25-4)22(18)14-17-8-6-5-7-9-17/h5-9,12,16H,10-11,13-15H2,1-4H3 |
| InChIKey | NXTJIXFCSHRVGE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine?
The IUPAC name of N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine (CID 26406980) is N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine.
What is the SMILES notation for N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine?
The canonical SMILES for N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine is COCCS(=O)(=O)c1ncc(CN(C)CC(C)C)n1Cc1ccccc1.
What is the InChIKey of N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine?
The InChIKey is NXTJIXFCSHRVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O3S/c1-16(2)13-21(3)15-18-12-20-19(26(23,24)11-10-25-4)22(18)14-17-8-6-5-7-9-17/h5-9,12,16H,10-11,13-15H2,1-4H3.
What are the key properties of N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine?
N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine has a molecular weight of 379.53 g/mol, XLogP of 2.44, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-benzyl-2-(2-methoxyethylsulfonyl)imidazol-4-yl]methyl]-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 26406980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).