C17H20F2N2O4 — CID 26407043
5-[(2,4-difluorophenoxy)methyl]-N-(3-propan-2-yloxypropyl)-1,2-oxazole-3-carboxamide (PubChem CID 26407043) has the molecular formula C17H20F2N2O4 and a molecular weight of 354.35 g/mol. Its IUPAC name is 5-[(2,4-difluorophenoxy)methyl]-N-(3-propan-2-yloxypropyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[(2,4-difluorophenoxy)methyl]-N-(3-propan-2-yloxypropyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 26407043 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-[(2,4-difluorophenoxy)methyl]-N-(3-propan-2-yloxypropyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1cc(COc2ccc(F)cc2F)on1 |
| InChI | InChI=1S/C17H20F2N2O4/c1-11(2)23-7-3-6-20-17(22)15-9-13(25-21-15)10-24-16-5-4-12(18)8-14(16)19/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,20,22) |
| InChIKey | AUVYAMKWXDIZPR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|