About [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate
[2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate (PubChem CID 2640714) has the molecular formula C14H11BrO4S
and a molecular weight of 355.21 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate |
| PubChem CID | 2640714 |
| Molecular Formula | C14H11BrO4S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H11BrO4S/c1-18-10-4-2-3-9(7-10)14(17)19-8-11(16)12-5-6-13(15)20-12/h2-7H,8H2,1H3 |
| InChIKey | VUQDBFUFBZVYCW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate?
The IUPAC name of [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate (CID 2640714) is [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate.
What is the SMILES notation for [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate?
The canonical SMILES for [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate is COc1cccc(C(=O)OCC(=O)c2ccc(Br)s2)c1.
What is the InChIKey of [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate?
The InChIKey is VUQDBFUFBZVYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrO4S/c1-18-10-4-2-3-9(7-10)14(17)19-8-11(16)12-5-6-13(15)20-12/h2-7H,8H2,1H3.
What are the key properties of [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate?
[2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate has a molecular weight of 355.21 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-bromothiophen-2-yl)-2-oxoethyl] 3-methoxybenzoate is sourced from PubChem (CID 2640714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).