C24H30FN3O3 — CID 26407799
N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-1-oxido-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide (PubChem CID 26407799) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-1-oxido-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide.
| Compound Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-1-oxido-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 26407799 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-1-oxido-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(c1ccc[n+]([O-])c1)N(CC1CCN(Cc2ccccc2F)CC1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C24H30FN3O3/c25-23-8-2-1-5-20(23)16-26-12-9-19(10-13-26)15-27(18-22-7-4-14-31-22)24(29)21-6-3-11-28(30)17-21/h1-3,5-6,8,11,17,19,22H,4,7,9-10,12-16,18H2/t22-/m1/s1 |
| InChIKey | CSSBTQQLLXYEIB-JOCHJYFZSA-N |
| XLogP | 2.99 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|