C16H19F3N2O2 — CID 26408379
(2S)-N-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine-4-carboxamide (PubChem CID 26408379) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is (2S)-N-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | (2S)-N-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 26408379 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S)-N-prop-2-enyl-2-[[3-(trifluoromethyl)phenyl]methyl]morpholine-4-carboxamide |
| SMILES | C=CCNC(=O)N1CCO[C@@H](Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-2-6-20-15(22)21-7-8-23-14(11-21)10-12-4-3-5-13(9-12)16(17,18)19/h2-5,9,14H,1,6-8,10-11H2,(H,20,22)/t14-/m0/s1 |
| InChIKey | OTEVACSOJWGPFX-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|