C22H30N6O2S — CID 26409113
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-[5-[[methyl(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone (PubChem CID 26409113) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[5-[[methyl(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[5-[[methyl(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
|---|---|
| PubChem CID | 26409113 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[5-[[methyl(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2nc3sccn3c2CN(C)Cc2n[nH]c3c2CCCC3)C[C@H](C)O1 |
| InChI | InChI=1S/C22H30N6O2S/c1-14-10-27(11-15(2)30-14)21(29)20-19(28-8-9-31-22(28)23-20)13-26(3)12-18-16-6-4-5-7-17(16)24-25-18/h8-9,14-15H,4-7,10-13H2,1-3H3,(H,24,25)/t14-,15+ |
| InChIKey | ZFXMLEAXWCUYQD-GASCZTMLSA-N |
| XLogP | 2.88 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |