C20H24FN5O2 — CID 26409503
(3aS,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-3-[3-(4-fluorophenyl)propyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 26409503) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is (3aS,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-3-[3-(4-fluorophenyl)propyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-3-[3-(4-fluorophenyl)propyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 26409503 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3aS,6aR)-5-[6-(dimethylamino)pyrimidin-4-yl]-3-[3-(4-fluorophenyl)propyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | CN(C)c1cc(N2C[C@H]3OC(=O)N(CCCc4ccc(F)cc4)[C@H]3C2)ncn1 |
| InChI | InChI=1S/C20H24FN5O2/c1-24(2)18-10-19(23-13-22-18)25-11-16-17(12-25)28-20(27)26(16)9-3-4-14-5-7-15(21)8-6-14/h5-8,10,13,16-17H,3-4,9,11-12H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | OWFNAJJRFGOGSN-DLBZAZTESA-N |
| XLogP | 2.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |