About [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 2641517) has the molecular formula C12H16N2O4S
and a molecular weight of 284.34 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate |
| PubChem CID | 2641517 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)c1cccs1 |
| InChI | InChI=1S/C12H16N2O4S/c1-8(2)6-13-12(17)14-10(15)7-18-11(16)9-4-3-5-19-9/h3-5,8H,6-7H2,1-2H3,(H2,13,14,15,17) |
| InChIKey | GHPQTGGSVXXJSC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate?
The IUPAC name of [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate (CID 2641517) is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate.
What is the SMILES notation for [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate?
The canonical SMILES for [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate is CC(C)CNC(=O)NC(=O)COC(=O)c1cccs1.
What is the InChIKey of [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate?
The InChIKey is GHPQTGGSVXXJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4S/c1-8(2)6-13-12(17)14-10(15)7-18-11(16)9-4-3-5-19-9/h3-5,8H,6-7H2,1-2H3,(H2,13,14,15,17).
What are the key properties of [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate?
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate has a molecular weight of 284.34 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] thiophene-2-carboxylate is sourced from PubChem (CID 2641517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).