C16H16N2OS — CID 26416268
(4R)-4-pyridin-4-yl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one (PubChem CID 26416268) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is (4R)-4-pyridin-4-yl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one.
| Compound Name | (4R)-4-pyridin-4-yl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 26416268 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4R)-4-pyridin-4-yl-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-2-one |
| SMILES | O=C1C[C@H](c2ccncc2)c2c(sc3c2CCCC3)N1 |
| InChI | InChI=1S/C16H16N2OS/c19-14-9-12(10-5-7-17-8-6-10)15-11-3-1-2-4-13(11)20-16(15)18-14/h5-8,12H,1-4,9H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | UTPQJXCMXOGIMU-GFCCVEGCSA-N |
| XLogP | 3.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |