C16H16Cl2N2O — CID 26416900
2-(3,4-dichloroanilino)-N-(2,5-dimethylphenyl)acetamide (PubChem CID 26416900) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(3,4-dichloroanilino)-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 26416900 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-(3,4-dichloroanilino)-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CNc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-10-3-4-11(2)15(7-10)20-16(21)9-19-12-5-6-13(17)14(18)8-12/h3-8,19H,9H2,1-2H3,(H,20,21) |
| InChIKey | FVZPTQYCPQUJEM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |