About [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 2642319) has the molecular formula C21H19NO7
and a molecular weight of 397.38 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| PubChem CID | 2642319 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)c2ccc3c(c2)NC(=O)CO3)c1OC |
| InChI | InChI=1S/C21H19NO7/c1-26-18-5-3-4-13(21(18)27-2)7-9-20(25)29-11-16(23)14-6-8-17-15(10-14)22-19(24)12-28-17/h3-10H,11-12H2,1-2H3,(H,22,24)/b9-7+ |
| InChIKey | KHIVSNFXFQTVPX-VQHVLOKHSA-N |
| XLogP | 2.47 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate?
The IUPAC name of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (CID 2642319) is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
What is the SMILES notation for [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate?
The canonical SMILES for [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate is COc1cccc(/C=C/C(=O)OCC(=O)c2ccc3c(c2)NC(=O)CO3)c1OC.
What is the InChIKey of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate?
The InChIKey is KHIVSNFXFQTVPX-VQHVLOKHSA-N. The full InChI is InChI=1S/C21H19NO7/c1-26-18-5-3-4-13(21(18)27-2)7-9-20(25)29-11-16(23)14-6-8-17-15(10-14)22-19(24)12-28-17/h3-10H,11-12H2,1-2H3,(H,22,24)/b9-7+.
What are the key properties of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate?
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate has a molecular weight of 397.38 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate is sourced from PubChem (CID 2642319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).