C21H30O5 — CID 26432734
(E)-5-[(1S,4aR,8aR)-5,5,8a-trimethyl-2-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enoic acid (PubChem CID 26432734) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (E)-5-[(1S,4aR,8aR)-5,5,8a-trimethyl-2-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enoic acid.
| Compound Name | (E)-5-[(1S,4aR,8aR)-5,5,8a-trimethyl-2-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 26432734 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (E)-5-[(1S,4aR,8aR)-5,5,8a-trimethyl-2-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enoic acid |
| SMILES | CC(=O)OC/C(=C/C(=O)O)CC[C@@H]1C(=O)C=C[C@@H]2C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C21H30O5/c1-14(22)26-13-15(12-19(24)25)6-7-16-17(23)8-9-18-20(2,3)10-5-11-21(16,18)4/h8-9,12,16,18H,5-7,10-11,13H2,1-4H3,(H,24,25)/b15-12+/t16-,18-,21+/m1/s1 |
| InChIKey | OIBHYUYKCMPFJH-IDGAIEGJSA-N |
| XLogP | 3.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|