C18H17N3O3 — CID 2643412
3-[(3,5-dimethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 2643412) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 2643412 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C)nc3ccccc3c2=O)cc(OC)c1 |
| InChI | InChI=1S/C18H17N3O3/c1-12-20-17-7-5-4-6-16(17)18(22)21(12)19-11-13-8-14(23-2)10-15(9-13)24-3/h4-11H,1-3H3 |
| InChIKey | WCOOGBSMDMCFDK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|