C15H16ClN3 — CID 26434353
(6S)-6-tert-butyl-2-chloro-5,6,7,8-tetrahydroquinoline-3,4-dicarbonitrile (PubChem CID 26434353) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-chloro-5,6,7,8-tetrahydroquinoline-3,4-dicarbonitrile.
| Compound Name | (6S)-6-tert-butyl-2-chloro-5,6,7,8-tetrahydroquinoline-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 26434353 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (6S)-6-tert-butyl-2-chloro-5,6,7,8-tetrahydroquinoline-3,4-dicarbonitrile |
| SMILES | CC(C)(C)[C@H]1CCc2nc(Cl)c(C#N)c(C#N)c2C1 |
| InChI | InChI=1S/C15H16ClN3/c1-15(2,3)9-4-5-13-10(6-9)11(7-17)12(8-18)14(16)19-13/h9H,4-6H2,1-3H3/t9-/m0/s1 |
| InChIKey | ICKXMWQXKDCZMB-VIFPVBQESA-N |
| XLogP | 3.63 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|