C21H20N8 — CID 26436461
1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propylamino]-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 26436461) has the molecular formula C21H20N8 and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propylamino]-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propylamino]-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 26436461 |
| Molecular Formula | C21H20N8 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propylamino]-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | CCc1cc(NCCCc2[nH]nc(N)c2C#N)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C21H20N8/c1-2-13-10-19(25-9-5-7-16-15(12-23)20(24)28-27-16)29-18-8-4-3-6-17(18)26-21(29)14(13)11-22/h3-4,6,8,10,25H,2,5,7,9H2,1H3,(H3,24,27,28) |
| InChIKey | SCHYJUXHYPQCSO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|